Carboxylic acids and derivatives
Filtered Search Results
Ethyl 5-methylindole-2-carboxylate, 98%
CAS: 16382-15-3 Molecular Formula: C12H13NO2 Molecular Weight (g/mol): 203.241 MDL Number: MFCD00022703 InChI Key: KMVFKXFOPNKHEM-UHFFFAOYSA-N Synonym: ethyl 5-methylindole-2-carboxylate,2-carbethoxy-5-methylindole,5-methylindole-2-carboxylic acid ethyl ester,5-methyl-1h-indole-2-carboxylic acid ethyl ester,pubchem7940,acmc-1brcs,5-methyl-2-ethoxycarbonyl indole,ethyl 5-methyl-2-indolecarboxylate,5-methyl-1h-indole-2-carboxylic acid, ethyl ester PubChem CID: 232919 IUPAC Name: ethyl 5-methyl-1H-indole-2-carboxylate SMILES: CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C
| PubChem CID | 232919 |
|---|---|
| CAS | 16382-15-3 |
| Molecular Weight (g/mol) | 203.241 |
| MDL Number | MFCD00022703 |
| SMILES | CCOC(=O)C1=CC2=C(N1)C=CC(=C2)C |
| Synonym | ethyl 5-methylindole-2-carboxylate,2-carbethoxy-5-methylindole,5-methylindole-2-carboxylic acid ethyl ester,5-methyl-1h-indole-2-carboxylic acid ethyl ester,pubchem7940,acmc-1brcs,5-methyl-2-ethoxycarbonyl indole,ethyl 5-methyl-2-indolecarboxylate,5-methyl-1h-indole-2-carboxylic acid, ethyl ester |
| IUPAC Name | ethyl 5-methyl-1H-indole-2-carboxylate |
| InChI Key | KMVFKXFOPNKHEM-UHFFFAOYSA-N |
| Molecular Formula | C12H13NO2 |
Zinc citrate dihydrate, Reagent Grade, Zn 31% min
CAS: 5990-32-9 Molecular Formula: C12H14O16Zn3 Molecular Weight (g/mol): 610.368 MDL Number: MFCD00150587 InChI Key: OXAGUGIXGVHDGD-UHFFFAOYSA-H Synonym: zinc citrate dihydrate,unii-021ibv57il,acmc-20aj8r,citric acid zinc salt dihydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, zinc salt 2:3 , dihydrate,trizinc 2+ dicitrate dihydrate,zinc citrate, dihydrate, reagent,trizinc, ion zn2+ dicitrate dihydrate,zinc 2-hydroxypropane-1,2,3-tricarboxylate-water 3/2/2,1,2,3-propanetricarboxylic acid, 2-hydroxy-, zinc salt, hydrate 2:3:2 PubChem CID: 16213234 IUPAC Name: trizinc;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate SMILES: C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Zn+2].[Zn+2].[Zn+2]
| PubChem CID | 16213234 |
|---|---|
| CAS | 5990-32-9 |
| Molecular Weight (g/mol) | 610.368 |
| MDL Number | MFCD00150587 |
| SMILES | C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.C(C(=O)[O-])C(CC(=O)[O-])(C(=O)[O-])O.O.O.[Zn+2].[Zn+2].[Zn+2] |
| Synonym | zinc citrate dihydrate,unii-021ibv57il,acmc-20aj8r,citric acid zinc salt dihydrate,1,2,3-propanetricarboxylic acid, 2-hydroxy-, zinc salt 2:3 , dihydrate,trizinc 2+ dicitrate dihydrate,zinc citrate, dihydrate, reagent,trizinc, ion zn2+ dicitrate dihydrate,zinc 2-hydroxypropane-1,2,3-tricarboxylate-water 3/2/2,1,2,3-propanetricarboxylic acid, 2-hydroxy-, zinc salt, hydrate 2:3:2 |
| IUPAC Name | trizinc;2-hydroxypropane-1,2,3-tricarboxylate;dihydrate |
| InChI Key | OXAGUGIXGVHDGD-UHFFFAOYSA-H |
| Molecular Formula | C12H14O16Zn3 |
Ethylenediaminetetraacetic acid tripotassium salt
CAS: 17572-97-3 Molecular Formula: C10H13K3N2O8 Molecular Weight (g/mol): 406.52 MDL Number: MFCD00013304 InChI Key: FYZXEMANQYHCFX-UHFFFAOYSA-K Synonym: edetate tripotassium,tripotassium edta,edta tripotassium salt,ethylenediaminetetraacetic acid tripotassium salt,tripotassium hydrogen ethylenediaminetetraacetate,sequestrene 50k3,unii-kia5203u1h,tripotassium ethylenediaminetetraacetate,edta-3k,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tripotassium salt PubChem CID: 62717 IUPAC Name: tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate SMILES: [K+].[K+].[K+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O
| PubChem CID | 62717 |
|---|---|
| CAS | 17572-97-3 |
| Molecular Weight (g/mol) | 406.52 |
| MDL Number | MFCD00013304 |
| SMILES | [K+].[K+].[K+].OC(=O)CN(CCN(CC([O-])=O)CC([O-])=O)CC([O-])=O |
| Synonym | edetate tripotassium,tripotassium edta,edta tripotassium salt,ethylenediaminetetraacetic acid tripotassium salt,tripotassium hydrogen ethylenediaminetetraacetate,sequestrene 50k3,unii-kia5203u1h,tripotassium ethylenediaminetetraacetate,edta-3k,glycine, n,n'-1,2-ethanediylbis n-carboxymethyl-, tripotassium salt |
| IUPAC Name | tripotassium;2-[2-[bis(carboxylatomethyl)amino]ethyl-(carboxymethyl)amino]acetate |
| InChI Key | FYZXEMANQYHCFX-UHFFFAOYSA-K |
| Molecular Formula | C10H13K3N2O8 |
5-Keto-D-gluconic acid potassium salt, 98%
Molecular Formula: C6H10KO7 Molecular Weight (g/mol): 233.237 MDL Number: MFCD00069562 InChI Key: BJBNFUCYWPVFKM-YMDUGQBDSA-N Synonym: potassium 5-ketogluconate PubChem CID: 131855000 IUPAC Name: potassium;(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid SMILES: C(C(=O)C(C(C(C(=O)O)O)O)O)O.[K]
| PubChem CID | 131855000 |
|---|---|
| Molecular Weight (g/mol) | 233.237 |
| MDL Number | MFCD00069562 |
| SMILES | C(C(=O)C(C(C(C(=O)O)O)O)O)O.[K] |
| Synonym | potassium 5-ketogluconate |
| IUPAC Name | potassium;(2R,3S,4S)-2,3,4,6-tetrahydroxy-5-oxohexanoic acid |
| InChI Key | BJBNFUCYWPVFKM-YMDUGQBDSA-N |
| Molecular Formula | C6H10KO7 |
(Ethylenedinitrilo)tetraacetic Acid Disodium, Dihydrate, Reagent, ACS, 99-101%, Spectrum™ Chemical
Small and Specialty Supplier Partner
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
Small and/or specialty supplier based on Federal laws and SBA requirements.
Learn More
CAS: 6381-92-6 Molecular Formula: C10H18N2Na2O10 Molecular Weight (g/mol): 372.24 MDL Number: MFCD00150037,MFCD00003541 InChI Key: OVBJJZOQPCKUOR-UHFFFAOYSA-L IUPAC Name: disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate SMILES: O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O
| CAS | 6381-92-6 |
|---|---|
| Molecular Weight (g/mol) | 372.24 |
| MDL Number | MFCD00150037,MFCD00003541 |
| SMILES | O.O.[Na+].[Na+].OC(=O)CN(CCN(CC(O)=O)CC([O-])=O)CC([O-])=O |
| IUPAC Name | disodium 2-({2-[(carboxylatomethyl)(carboxymethyl)amino]ethyl}(carboxymethyl)amino)acetate dihydrate |
| InChI Key | OVBJJZOQPCKUOR-UHFFFAOYSA-L |
| Molecular Formula | C10H18N2Na2O10 |
Diazolidinyl urea, MP Biomedicals™
CAS: 78491-02-8 Molecular Formula: C8H14N4O7 Molecular Weight (g/mol): 278.221 InChI Key: SOROIESOUPGGFO-UHFFFAOYSA-N Synonym: diazolidinylurea,diazolidinyl urea,1-1,3-bis hydroxymethyl-2,5-dioxoimidazolidin-4-yl-1,3-bis hydroxymethyl urea,germall ii,germall 11,imidazolidinyl urea 11,n,n'-bis hydroxymethyl urea,dsstox_cid_9559,dsstox_rid_78776 PubChem CID: 62277 IUPAC Name: 1-[1,3-bis(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-1,3-bis(hydroxymethyl)urea SMILES: C(NC(=O)N(CO)C1C(=O)N(C(=O)N1CO)CO)O
| PubChem CID | 62277 |
|---|---|
| CAS | 78491-02-8 |
| Molecular Weight (g/mol) | 278.221 |
| SMILES | C(NC(=O)N(CO)C1C(=O)N(C(=O)N1CO)CO)O |
| Synonym | diazolidinylurea,diazolidinyl urea,1-1,3-bis hydroxymethyl-2,5-dioxoimidazolidin-4-yl-1,3-bis hydroxymethyl urea,germall ii,germall 11,imidazolidinyl urea 11,n,n'-bis hydroxymethyl urea,dsstox_cid_9559,dsstox_rid_78776 |
| IUPAC Name | 1-[1,3-bis(hydroxymethyl)-2,5-dioxoimidazolidin-4-yl]-1,3-bis(hydroxymethyl)urea |
| InChI Key | SOROIESOUPGGFO-UHFFFAOYSA-N |
| Molecular Formula | C8H14N4O7 |
Thermo Scientific Chemicals 1,2,3,4,6-Penta-O-acetyl-D-mannopyranose, 98%
CAS: 25941-03-1 Molecular Formula: C16H22O11 Molecular Weight (g/mol): 390.341 MDL Number: MFCD05864874 InChI Key: LPTITAGPBXDDGR-WHWZVRATSA-N Synonym: 1,2,3,4,6-penta-o-acetyl-d-mannopyranose,d-mannopyranose pentaacetate,3s,4s,5r,6r-6-acetoxymethyl tetrahydro-2h-pyran-2,3,4,5-tetrayl tetraacetate,2r,3r,4s,5s-3,4,5,6-tetrakis acetyloxy oxan-2-yl methyl acetate,mannopyranose pentaacetate,d-mannopyranose, pentaacetate,1,2,3,4,6-pentaacetate d-mannopyranose,d-mannopyranose,1,2,3,4,6-pentaacetate,1,2,3,4,6-penta-o-acetyl-dmannopyranose,1,2,3,4,6-penta-o-acetyl-alpha,beta-d-mannose PubChem CID: 11811209 IUPAC Name: [(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate SMILES: CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C
| PubChem CID | 11811209 |
|---|---|
| CAS | 25941-03-1 |
| Molecular Weight (g/mol) | 390.341 |
| MDL Number | MFCD05864874 |
| SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C |
| Synonym | 1,2,3,4,6-penta-o-acetyl-d-mannopyranose,d-mannopyranose pentaacetate,3s,4s,5r,6r-6-acetoxymethyl tetrahydro-2h-pyran-2,3,4,5-tetrayl tetraacetate,2r,3r,4s,5s-3,4,5,6-tetrakis acetyloxy oxan-2-yl methyl acetate,mannopyranose pentaacetate,d-mannopyranose, pentaacetate,1,2,3,4,6-pentaacetate d-mannopyranose,d-mannopyranose,1,2,3,4,6-pentaacetate,1,2,3,4,6-penta-o-acetyl-dmannopyranose,1,2,3,4,6-penta-o-acetyl-alpha,beta-d-mannose |
| IUPAC Name | [(2R,3R,4S,5S)-3,4,5,6-tetraacetyloxyoxan-2-yl]methyl acetate |
| InChI Key | LPTITAGPBXDDGR-WHWZVRATSA-N |
| Molecular Formula | C16H22O11 |
2,2,3,3,4,4,4-Heptafluorobutyl methacrylate, 97%, stab.
CAS: 13695-31-3 Molecular Formula: C8H7F7O2 Molecular Weight (g/mol): 268.131 MDL Number: MFCD00039251 InChI Key: VIEHKBXCWMMOOU-UHFFFAOYSA-N Synonym: heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # PubChem CID: 83666 IUPAC Name: 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate SMILES: CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F
| PubChem CID | 83666 |
|---|---|
| CAS | 13695-31-3 |
| Molecular Weight (g/mol) | 268.131 |
| MDL Number | MFCD00039251 |
| SMILES | CC(=C)C(=O)OCC(C(C(F)(F)F)(F)F)(F)F |
| Synonym | heptafluorobutyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl methacrylate,1h,1h-heptafluorobutyl methacrylate,1h,1h-heptafluoro-n-butyl methacrylate,2-propenoic acid, 2-methyl-, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid, 2,2,3,3,4,4,4-heptafluorobutyl ester,methacrylic acid 2,2,3,3,4,4,4-heptafluorobutyl ester,heptafluoropropylmethyl methacrylate,2,2,3,3,4,4,4-heptafluorobutyl 2-methylacrylate # |
| IUPAC Name | 2,2,3,3,4,4,4-heptafluorobutyl 2-methylprop-2-enoate |
| InChI Key | VIEHKBXCWMMOOU-UHFFFAOYSA-N |
| Molecular Formula | C8H7F7O2 |
2-Mercaptopropionic acid, 97%
CAS: 79-42-5 Molecular Formula: C3H6O2S Molecular Weight (g/mol): 106.14 MDL Number: MFCD00004862 InChI Key: PMNLUUOXGOOLSP-UHFFFAOYNA-N Synonym: 2-mercaptopropionic acid,thiolactic acid,2-mercaptopropanoic acid,2-thiolactic acid,2-thiolpropionic acid,alpha-mercaptopropionic acid,alpha-mercaptopropanoic acid,propionic acid, 2-mercapto,propanoic acid, 2-mercapto,fema no. 3180 PubChem CID: 62326 ChEBI: CHEBI:47872 IUPAC Name: 2-sulfanylpropanoic acid SMILES: CC(S)C(O)=O
| PubChem CID | 62326 |
|---|---|
| CAS | 79-42-5 |
| Molecular Weight (g/mol) | 106.14 |
| ChEBI | CHEBI:47872 |
| MDL Number | MFCD00004862 |
| SMILES | CC(S)C(O)=O |
| Synonym | 2-mercaptopropionic acid,thiolactic acid,2-mercaptopropanoic acid,2-thiolactic acid,2-thiolpropionic acid,alpha-mercaptopropionic acid,alpha-mercaptopropanoic acid,propionic acid, 2-mercapto,propanoic acid, 2-mercapto,fema no. 3180 |
| IUPAC Name | 2-sulfanylpropanoic acid |
| InChI Key | PMNLUUOXGOOLSP-UHFFFAOYNA-N |
| Molecular Formula | C3H6O2S |
Acethydrazide, 95%
CAS: 1068-57-1 Molecular Formula: C2H6N2O Molecular Weight (g/mol): 74.08 MDL Number: MFCD00007610 InChI Key: OFLXLNCGODUUOT-UHFFFAOYSA-N Synonym: acethydrazide,acetylhydrazine,acetic hydrazide,acetic acid hydrazide,acetyl hydrazide,monoacetylhydrazine,n-acetylhydrazine,ethanehydrazonic acid,acetic acid, hydrazide,acetyl hydrazine PubChem CID: 14039 ChEBI: CHEBI:48978 IUPAC Name: acetohydrazide SMILES: CC(=O)NN
| PubChem CID | 14039 |
|---|---|
| CAS | 1068-57-1 |
| Molecular Weight (g/mol) | 74.08 |
| ChEBI | CHEBI:48978 |
| MDL Number | MFCD00007610 |
| SMILES | CC(=O)NN |
| Synonym | acethydrazide,acetylhydrazine,acetic hydrazide,acetic acid hydrazide,acetyl hydrazide,monoacetylhydrazine,n-acetylhydrazine,ethanehydrazonic acid,acetic acid, hydrazide,acetyl hydrazine |
| IUPAC Name | acetohydrazide |
| InChI Key | OFLXLNCGODUUOT-UHFFFAOYSA-N |
| Molecular Formula | C2H6N2O |
Ethyl butyrate, 99%
CAS: 105-54-4 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00009394 InChI Key: OBNCKNCVKJNDBV-UHFFFAOYSA-N Synonym: ethyl butyrate,butyric acid ethyl ester,ethyl n-butyrate,butanoic acid, ethyl ester,butyric ester,butyric ether,butyric acid, ethyl ester,ethyl n-butanoate,butanoic acid ethyl ester,fema number 2427 PubChem CID: 7762 IUPAC Name: ethyl butanoate SMILES: CCCC(=O)OCC
| PubChem CID | 7762 |
|---|---|
| CAS | 105-54-4 |
| Molecular Weight (g/mol) | 116.16 |
| MDL Number | MFCD00009394 |
| SMILES | CCCC(=O)OCC |
| Synonym | ethyl butyrate,butyric acid ethyl ester,ethyl n-butyrate,butanoic acid, ethyl ester,butyric ester,butyric ether,butyric acid, ethyl ester,ethyl n-butanoate,butanoic acid ethyl ester,fema number 2427 |
| IUPAC Name | ethyl butanoate |
| InChI Key | OBNCKNCVKJNDBV-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
Ethyl 4-bromocrotonate, 75%, tech.
CAS: 37746-78-4 Molecular Formula: C6H9BrO2 Molecular Weight (g/mol): 193.04 MDL Number: MFCD00000247 InChI Key: FHGRPBSDPBRTLS-ONEGZZNKSA-N Synonym: ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate PubChem CID: 5373944 IUPAC Name: ethyl (E)-4-bromobut-2-enoate SMILES: CCOC(=O)C=CCBr
| PubChem CID | 5373944 |
|---|---|
| CAS | 37746-78-4 |
| Molecular Weight (g/mol) | 193.04 |
| MDL Number | MFCD00000247 |
| SMILES | CCOC(=O)C=CCBr |
| Synonym | ethyl 4-bromocrotonate,e-ethyl 4-bromobut-2-enoate,ethyl 4-bromobut-2-enoate,4-bromocrotonic acid ethyl ester,ethyl 2e-4-bromobut-2-enoate,2-butenoic acid, 4-bromo-, ethyl ester, e,2-butenoic acid, 4-bromo-, ethyl ester,ethyl e-4-bromo-2-butenoate,ethyl e-4-bromobut-2-enoate,ethyl trans-4-bromo-2-butenoate |
| IUPAC Name | ethyl (E)-4-bromobut-2-enoate |
| InChI Key | FHGRPBSDPBRTLS-ONEGZZNKSA-N |
| Molecular Formula | C6H9BrO2 |
Indole-2-carboxylic acid, 99%
CAS: 1477-50-5 Molecular Formula: C9H7NO2 Molecular Weight (g/mol): 161.16 MDL Number: MFCD00005611 InChI Key: HCUARRIEZVDMPT-UHFFFAOYSA-N Synonym: indole-2-carboxylic acid,2-carboxyindole,2-indolecarboxylic acid,indol-2-carboxylic acid,1h-indolecarboxylic acid,indole-2-carboxylate,2-indolylformic acid,2-indole carboxylic acid,1h-indol-2-carbons,carboxyindole PubChem CID: 72899 IUPAC Name: 1H-indole-2-carboxylic acid SMILES: OC(=O)C1=CC2=CC=CC=C2N1
| PubChem CID | 72899 |
|---|---|
| CAS | 1477-50-5 |
| Molecular Weight (g/mol) | 161.16 |
| MDL Number | MFCD00005611 |
| SMILES | OC(=O)C1=CC2=CC=CC=C2N1 |
| Synonym | indole-2-carboxylic acid,2-carboxyindole,2-indolecarboxylic acid,indol-2-carboxylic acid,1h-indolecarboxylic acid,indole-2-carboxylate,2-indolylformic acid,2-indole carboxylic acid,1h-indol-2-carbons,carboxyindole |
| IUPAC Name | 1H-indole-2-carboxylic acid |
| InChI Key | HCUARRIEZVDMPT-UHFFFAOYSA-N |
| Molecular Formula | C9H7NO2 |
o-Tolylacetic acid, 99%
CAS: 644-36-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00004328 InChI Key: RZWGTXHSYZGXKF-UHFFFAOYSA-N Synonym: o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid PubChem CID: 69519 IUPAC Name: 2-(2-methylphenyl)acetic acid SMILES: CC1=CC=CC=C1CC(=O)O
| PubChem CID | 69519 |
|---|---|
| CAS | 644-36-0 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00004328 |
| SMILES | CC1=CC=CC=C1CC(=O)O |
| Synonym | o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid |
| IUPAC Name | 2-(2-methylphenyl)acetic acid |
| InChI Key | RZWGTXHSYZGXKF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
| CAS | 3-4-4342 |
|---|---|
| MDL Number | MFCD00057167 |